C23H16N2O2 — CID 126121074
2-[[2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]methyl]benzonitrile (PubChem CID 126121074) has the molecular formula C23H16N2O2 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[[2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126121074 |
| Molecular Formula | C23H16N2O2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-[[2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1ccccc1/C=C1\C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C23H16N2O2/c24-14-17-8-1-2-9-18(17)15-27-22-12-6-3-7-16(22)13-20-19-10-4-5-11-21(19)25-23(20)26/h1-13H,15H2,(H,25,26)/b20-13- |
| InChIKey | QBDNVAZVXNXTLI-MOSHPQCFSA-N |
| XLogP | 4.63 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|