C25H19N3O3S — CID 6242789
2-[[2-[(Z)-[1-(4-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 6242789) has the molecular formula C25H19N3O3S and a molecular weight of 441.51 g/mol. Its IUPAC name is 2-[[2-[(Z)-[1-(4-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-[(Z)-[1-(4-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 6242789 |
| Molecular Formula | C25H19N3O3S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-[[2-[(Z)-[1-(4-methoxyphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | COc1ccc(N2C(=O)/C(=C/c3ccccc3OCc3ccccc3C#N)NC2=S)cc1 |
| InChI | InChI=1S/C25H19N3O3S/c1-30-21-12-10-20(11-13-21)28-24(29)22(27-25(28)32)14-17-6-4-5-9-23(17)31-16-19-8-3-2-7-18(19)15-26/h2-14H,16H2,1H3,(H,27,32)/b22-14- |
| InChIKey | KLVSNYNKFYTVFK-HMAPJEAMSA-N |
| XLogP | 4.41 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|