C25H17BrClN3O4 — CID 126241114
2-[[2-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 126241114) has the molecular formula C25H17BrClN3O4 and a molecular weight of 538.79 g/mol. Its IUPAC name is 2-[[2-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126241114 |
| Molecular Formula | C25H17BrClN3O4 |
| Molecular Weight | 538.79 g/mol |
| Exact Mass | 537.01 |
| IUPAC Name | 2-[[2-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)cc(Br)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C25H17BrClN3O4/c1-33-22-12-15(10-20(26)23(22)34-14-17-5-3-2-4-16(17)13-28)11-21-24(31)30(25(32)29-21)19-8-6-18(27)7-9-19/h2-12H,14H2,1H3,(H,29,32)/b21-11+ |
| InChIKey | ATHOFKFJIAFSAX-SRZZPIQSSA-N |
| XLogP | 5.66 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.79 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|