C15H8F3NO — CID 66640531
3-[(2,5-difluorophenyl)methylidene]-6-fluoro-1H-indol-2-one (PubChem CID 66640531) has the molecular formula C15H8F3NO and a molecular weight of 275.23 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methylidene]-6-fluoro-1H-indol-2-one.
| Compound Name | 3-[(2,5-difluorophenyl)methylidene]-6-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 66640531 |
| Molecular Formula | C15H8F3NO |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methylidene]-6-fluoro-1H-indol-2-one |
| SMILES | O=C1Nc2cc(F)ccc2C1=Cc1cc(F)ccc1F |
| InChI | InChI=1S/C15H8F3NO/c16-9-2-4-13(18)8(5-9)6-12-11-3-1-10(17)7-14(11)19-15(12)20/h1-7H,(H,19,20) |
| InChIKey | VFUGDEAEUMOTQU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|