C21H19ClFNO4 — CID 86632067
ethyl 2-[2-[(Z)-(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]-4-fluorophenoxy]-2-methylpropanoate (PubChem CID 86632067) has the molecular formula C21H19ClFNO4 and a molecular weight of 403.84 g/mol. Its IUPAC name is ethyl 2-[2-[(Z)-(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]-4-fluorophenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[2-[(Z)-(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]-4-fluorophenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 86632067 |
| Molecular Formula | C21H19ClFNO4 |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | ethyl 2-[2-[(Z)-(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]-4-fluorophenoxy]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(F)cc1/C=C1\C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H19ClFNO4/c1-4-27-20(26)21(2,3)28-18-8-6-14(23)9-12(18)10-16-15-7-5-13(22)11-17(15)24-19(16)25/h5-11H,4H2,1-3H3,(H,24,25)/b16-10- |
| InChIKey | HTKIMQXMIDWFSP-YBEGLDIGSA-N |
| XLogP | 4.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|