C17H13Cl2NO3S — CID 131728300
(3Z)-6-chloro-3-[[5-chloro-2-(methylsulfinylmethoxy)phenyl]methylidene]-1H-indol-2-one (PubChem CID 131728300) has the molecular formula C17H13Cl2NO3S and a molecular weight of 382.27 g/mol. Its IUPAC name is (3Z)-6-chloro-3-[[5-chloro-2-(methylsulfinylmethoxy)phenyl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-6-chloro-3-[[5-chloro-2-(methylsulfinylmethoxy)phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 131728300 |
| Molecular Formula | C17H13Cl2NO3S |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | (3Z)-6-chloro-3-[[5-chloro-2-(methylsulfinylmethoxy)phenyl]methylidene]-1H-indol-2-one |
| SMILES | CS(=O)COc1ccc(Cl)cc1/C=C1\C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H13Cl2NO3S/c1-24(22)9-23-16-5-3-11(18)6-10(16)7-14-13-4-2-12(19)8-15(13)20-17(14)21/h2-8H,9H2,1H3,(H,20,21)/b14-7- |
| InChIKey | QEXACFVDHRHSES-AUWJEWJLSA-N |
| XLogP | 4.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|