C11H10ClNO — CID 59774782
(3E)-6-chloro-3-propylidene-1H-indol-2-one (PubChem CID 59774782) has the molecular formula C11H10ClNO and a molecular weight of 207.66 g/mol. Its IUPAC name is (3E)-6-chloro-3-propylidene-1H-indol-2-one.
| Compound Name | (3E)-6-chloro-3-propylidene-1H-indol-2-one |
|---|---|
| PubChem CID | 59774782 |
| Molecular Formula | C11H10ClNO |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | (3E)-6-chloro-3-propylidene-1H-indol-2-one |
| SMILES | CC/C=C1/C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H10ClNO/c1-2-3-9-8-5-4-7(12)6-10(8)13-11(9)14/h3-6H,2H2,1H3,(H,13,14)/b9-3+ |
| InChIKey | NTMDIJLHTNCWKX-YCRREMRBSA-N |
| XLogP | 3.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|