C28H21FN2O4 — CID 46249925
4-[(Z)-[4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 46249925) has the molecular formula C28H21FN2O4 and a molecular weight of 468.48 g/mol. Its IUPAC name is 4-[(Z)-[4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 4-[(Z)-[4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 46249925 |
| Molecular Formula | C28H21FN2O4 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 4-[(Z)-[4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccco1)c1ccc(/C=C2\Oc3ccccc3N(Cc3cccc(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C28H21FN2O4/c29-22-6-3-5-20(15-22)18-31-24-8-1-2-9-25(24)35-26(28(31)33)16-19-10-12-21(13-11-19)27(32)30-17-23-7-4-14-34-23/h1-16H,17-18H2,(H,30,32)/b26-16- |
| InChIKey | QZXAGMLTEBPGEQ-QQXSKIMKSA-N |
| XLogP | 5.32 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|