C36H34N2O3 — CID 46258961
(2E)-2-[[4-(4-benzylpiperidine-1-carbonyl)phenyl]methylidene]-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one (PubChem CID 46258961) has the molecular formula C36H34N2O3 and a molecular weight of 542.68 g/mol. Its IUPAC name is (2E)-2-[[4-(4-benzylpiperidine-1-carbonyl)phenyl]methylidene]-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one.
| Compound Name | (2E)-2-[[4-(4-benzylpiperidine-1-carbonyl)phenyl]methylidene]-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 46258961 |
| Molecular Formula | C36H34N2O3 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | (2E)-2-[[4-(4-benzylpiperidine-1-carbonyl)phenyl]methylidene]-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one |
| SMILES | Cc1cccc(CN2C(=O)/C(=C\c3ccc(C(=O)N4CCC(Cc5ccccc5)CC4)cc3)Oc3ccccc32)c1 |
| InChI | InChI=1S/C36H34N2O3/c1-26-8-7-11-30(22-26)25-38-32-12-5-6-13-33(32)41-34(36(38)40)24-28-14-16-31(17-15-28)35(39)37-20-18-29(19-21-37)23-27-9-3-2-4-10-27/h2-17,22,24,29H,18-21,23,25H2,1H3/b34-24+ |
| InChIKey | WSPOEKYGSXXJBX-JGRMKTMXSA-N |
| XLogP | 7.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|