C24H24N2O5 — CID 4062384
ethyl 1-[4-[(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]benzoyl]piperidine-3-carboxylate (PubChem CID 4062384) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is ethyl 1-[4-[(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[4-[(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 4062384 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | ethyl 1-[4-[(3-oxo-4H-1,4-benzoxazin-2-ylidene)methyl]benzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccc(C=C3Oc4ccccc4NC3=O)cc2)C1 |
| InChI | InChI=1S/C24H24N2O5/c1-2-30-24(29)18-6-5-13-26(15-18)23(28)17-11-9-16(10-12-17)14-21-22(27)25-19-7-3-4-8-20(19)31-21/h3-4,7-12,14,18H,2,5-6,13,15H2,1H3,(H,25,27) |
| InChIKey | QVSJTAZIQQJPOO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|