C13H11BrN6O3 — CID 135643159
(4E)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-5-methyl-2-(2H-tetrazol-5-yl)pyrazol-3-one (PubChem CID 135643159) has the molecular formula C13H11BrN6O3 and a molecular weight of 379.17 g/mol. Its IUPAC name is (4E)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-5-methyl-2-(2H-tetrazol-5-yl)pyrazol-3-one.
| Compound Name | (4E)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-5-methyl-2-(2H-tetrazol-5-yl)pyrazol-3-one |
|---|---|
| PubChem CID | 135643159 |
| Molecular Formula | C13H11BrN6O3 |
| Molecular Weight | 379.17 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | (4E)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-5-methyl-2-(2H-tetrazol-5-yl)pyrazol-3-one |
| SMILES | COc1cc(/C=C2/C(=O)N(c3nn[nH]n3)N=C2C)cc(Br)c1O |
| InChI | InChI=1S/C13H11BrN6O3/c1-6-8(12(22)20(17-6)13-15-18-19-16-13)3-7-4-9(14)11(21)10(5-7)23-2/h3-5,21H,1-2H3,(H,15,16,18,19)/b8-3+ |
| InChIKey | LHANAUQMENPQGD-FPYGCLRLSA-N |
| XLogP | 1.48 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|