C13H11N6O3- — CID 7258225
2-methoxy-4-[(E)-[3-methyl-5-oxo-1-(2H-tetrazol-5-yl)pyrazol-4-ylidene]methyl]phenolate (PubChem CID 7258225) has the molecular formula C13H11N6O3- and a molecular weight of 299.27 g/mol. Its IUPAC name is 2-methoxy-4-[(E)-[3-methyl-5-oxo-1-(2H-tetrazol-5-yl)pyrazol-4-ylidene]methyl]phenolate.
| Compound Name | 2-methoxy-4-[(E)-[3-methyl-5-oxo-1-(2H-tetrazol-5-yl)pyrazol-4-ylidene]methyl]phenolate |
|---|---|
| PubChem CID | 7258225 |
| Molecular Formula | C13H11N6O3- |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-methoxy-4-[(E)-[3-methyl-5-oxo-1-(2H-tetrazol-5-yl)pyrazol-4-ylidene]methyl]phenolate |
| SMILES | COc1cc(/C=C2/C(=O)N(c3nn[nH]n3)N=C2C)ccc1[O-] |
| InChI | InChI=1S/C13H12N6O3/c1-7-9(5-8-3-4-10(20)11(6-8)22-2)12(21)19(16-7)13-14-17-18-15-13/h3-6,20H,1-2H3,(H,14,15,17,18)/p-1/b9-5+ |
| InChIKey | AGHDDYJNUGRNGZ-WEVVVXLNSA-M |
| XLogP | 0.09 |
| TPSA | 119.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|