C15H15N6O3- — CID 7298259
(4Z)-4-[(4-ethoxy-3-methoxyphenyl)methylidene]-5-methyl-2-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyrazol-3-one (PubChem CID 7298259) has the molecular formula C15H15N6O3- and a molecular weight of 327.32 g/mol. Its IUPAC name is (4Z)-4-[(4-ethoxy-3-methoxyphenyl)methylidene]-5-methyl-2-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyrazol-3-one.
| Compound Name | (4Z)-4-[(4-ethoxy-3-methoxyphenyl)methylidene]-5-methyl-2-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyrazol-3-one |
|---|---|
| PubChem CID | 7298259 |
| Molecular Formula | C15H15N6O3- |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (4Z)-4-[(4-ethoxy-3-methoxyphenyl)methylidene]-5-methyl-2-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyrazol-3-one |
| SMILES | CCOc1ccc(/C=C2\C(=O)N(c3nnn[n-]3)N=C2C)cc1OC |
| InChI | InChI=1S/C15H15N6O3/c1-4-24-12-6-5-10(8-13(12)23-3)7-11-9(2)18-21(14(11)22)15-16-19-20-17-15/h5-8H,4H2,1-3H3/q-1/b11-7- |
| InChIKey | OSLDAESAKAKSQF-XFFZJAGNSA-N |
| XLogP | 1.04 |
| TPSA | 103.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|