C18H15BrN2O6S — CID 135481584
4-[(4Z)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonic acid (PubChem CID 135481584) has the molecular formula C18H15BrN2O6S and a molecular weight of 467.30 g/mol. Its IUPAC name is 4-[(4Z)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonic acid.
| Compound Name | 4-[(4Z)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135481584 |
| Molecular Formula | C18H15BrN2O6S |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | 4-[(4Z)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonic acid |
| SMILES | COc1cc(/C=C2\C(=O)N(c3ccc(S(=O)(=O)O)cc3)N=C2C)cc(Br)c1O |
| InChI | InChI=1S/C18H15BrN2O6S/c1-10-14(7-11-8-15(19)17(22)16(9-11)27-2)18(23)21(20-10)12-3-5-13(6-4-12)28(24,25)26/h3-9,22H,1-2H3,(H,24,25,26)/b14-7- |
| InChIKey | UGBTVECEZMILAV-AUWJEWJLSA-N |
| XLogP | 3.22 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|