C22H15Br2NO2S2 — CID 50870861
(5E)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 50870861) has the molecular formula C22H15Br2NO2S2 and a molecular weight of 549.31 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50870861 |
| Molecular Formula | C22H15Br2NO2S2 |
| Molecular Weight | 549.31 g/mol |
| Exact Mass | 546.89 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\c2cc(Br)c(OCc3cccc4ccccc34)c(Br)c2)SC1=S |
| InChI | InChI=1S/C22H15Br2NO2S2/c1-25-21(26)19(29-22(25)28)11-13-9-17(23)20(18(24)10-13)27-12-15-7-4-6-14-5-2-3-8-16(14)15/h2-11H,12H2,1H3/b19-11+ |
| InChIKey | PKXGJHCFHAZBTP-YBFXNURJSA-N |
| XLogP | 6.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.31 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|