C27H23BrO6 — CID 124539366
8-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione (PubChem CID 124539366) has the molecular formula C27H23BrO6 and a molecular weight of 523.38 g/mol. Its IUPAC name is 8-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 124539366 |
| Molecular Formula | C27H23BrO6 |
| Molecular Weight | 523.38 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 8-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione |
| SMILES | COc1cc(C=C2C(=O)OC3(CCCC3)OC2=O)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C27H23BrO6/c1-31-23-15-17(13-21-25(29)33-27(34-26(21)30)11-4-5-12-27)14-22(28)24(23)32-16-19-9-6-8-18-7-2-3-10-20(18)19/h2-3,6-10,13-15H,4-5,11-12,16H2,1H3 |
| InChIKey | HVOACHACMVFAKX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.38 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|