C28H25BrO6 — CID 124539347
3-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione (PubChem CID 124539347) has the molecular formula C28H25BrO6 and a molecular weight of 537.41 g/mol. Its IUPAC name is 3-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 124539347 |
| Molecular Formula | C28H25BrO6 |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | 3-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
| SMILES | COc1cc(C=C2C(=O)OC3(CCCCC3)OC2=O)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H25BrO6/c1-32-24-16-18(14-22-26(30)34-28(35-27(22)31)12-5-2-6-13-28)15-23(29)25(24)33-17-20-10-7-9-19-8-3-4-11-21(19)20/h3-4,7-11,14-16H,2,5-6,12-13,17H2,1H3 |
| InChIKey | DSFRCCNQFOFVDH-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|