C33H26BrClN2O5 — CID 124602808
5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-bis(2-methylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 124602808) has the molecular formula C33H26BrClN2O5 and a molecular weight of 645.94 g/mol. Its IUPAC name is 5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-bis(2-methylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-bis(2-methylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124602808 |
| Molecular Formula | C33H26BrClN2O5 |
| Molecular Weight | 645.94 g/mol |
| Exact Mass | 644.07 |
| IUPAC Name | 5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-bis(2-methylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(C=C2C(=O)N(c3ccccc3C)C(=O)N(c3ccccc3C)C2=O)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C33H26BrClN2O5/c1-20-10-4-8-14-27(20)36-31(38)24(32(39)37(33(36)40)28-15-9-5-11-21(28)2)16-22-17-25(34)30(29(18-22)41-3)42-19-23-12-6-7-13-26(23)35/h4-18H,19H2,1-3H3 |
| InChIKey | CUXLKZZKYNRJBK-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.94 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|