C20H12Br2N2O4 — CID 126056007
(5E)-5-[(3,5-dibromo-2-prop-2-ynoxyphenyl)methylidene]-1-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 126056007) has the molecular formula C20H12Br2N2O4 and a molecular weight of 504.13 g/mol. Its IUPAC name is (5E)-5-[(3,5-dibromo-2-prop-2-ynoxyphenyl)methylidene]-1-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(3,5-dibromo-2-prop-2-ynoxyphenyl)methylidene]-1-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126056007 |
| Molecular Formula | C20H12Br2N2O4 |
| Molecular Weight | 504.13 g/mol |
| Exact Mass | 501.92 |
| IUPAC Name | (5E)-5-[(3,5-dibromo-2-prop-2-ynoxyphenyl)methylidene]-1-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | C#CCOc1c(Br)cc(Br)cc1/C=C1\C(=O)NC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H12Br2N2O4/c1-2-8-28-17-12(9-13(21)11-16(17)22)10-15-18(25)23-20(27)24(19(15)26)14-6-4-3-5-7-14/h1,3-7,9-11H,8H2,(H,23,25,27)/b15-10+ |
| InChIKey | WXECWSDIALBRRT-XNTDXEJSSA-N |
| XLogP | 3.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|