C28H25Cl2N3O4 — CID 19655669
2-[4-[(E)-[1-(3,4-dichlorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 19655669) has the molecular formula C28H25Cl2N3O4 and a molecular weight of 538.43 g/mol. Its IUPAC name is 2-[4-[(E)-[1-(3,4-dichlorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[(E)-[1-(3,4-dichlorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19655669 |
| Molecular Formula | C28H25Cl2N3O4 |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 2-[4-[(E)-[1-(3,4-dichlorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/C(=O)N(c3ccc(Cl)c(Cl)c3)N=C2C)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C28H25Cl2N3O4/c1-4-36-26-14-19(7-12-25(26)37-16-27(34)31-20-8-5-17(2)6-9-20)13-22-18(3)32-33(28(22)35)21-10-11-23(29)24(30)15-21/h5-15H,4,16H2,1-3H3,(H,31,34)/b22-13+ |
| InChIKey | CWYXLHVRFXUWKI-LPYMAVHISA-N |
| XLogP | 6.52 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|