C35H32N4O6 — CID 19655925
N-[4-[(4Z)-4-[[3-ethoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]phenyl]benzamide (PubChem CID 19655925) has the molecular formula C35H32N4O6 and a molecular weight of 604.66 g/mol. Its IUPAC name is N-[4-[(4Z)-4-[[3-ethoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]phenyl]benzamide.
| Compound Name | N-[4-[(4Z)-4-[[3-ethoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 19655925 |
| Molecular Formula | C35H32N4O6 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | N-[4-[(4Z)-4-[[3-ethoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]phenyl]benzamide |
| SMILES | CCOc1cc(/C=C2\C(=O)N(c3ccc(NC(=O)c4ccccc4)cc3)N=C2C)ccc1OCC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C35H32N4O6/c1-4-44-32-21-24(14-19-31(32)45-22-33(40)37-29-12-8-9-13-30(29)43-3)20-28-23(2)38-39(35(28)42)27-17-15-26(16-18-27)36-34(41)25-10-6-5-7-11-25/h5-21H,4,22H2,1-3H3,(H,36,41)(H,37,40)/b28-20- |
| InChIKey | NVECKUJGVSSPBL-RRAHZORUSA-N |
| XLogP | 6.17 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|