C29H27N3O7 — CID 19616784
3-[(4E)-4-[[4-[2-(4-ethoxyanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 19616784) has the molecular formula C29H27N3O7 and a molecular weight of 529.55 g/mol. Its IUPAC name is 3-[(4E)-4-[[4-[2-(4-ethoxyanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 3-[(4E)-4-[[4-[2-(4-ethoxyanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 19616784 |
| Molecular Formula | C29H27N3O7 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 3-[(4E)-4-[[4-[2-(4-ethoxyanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | CCOc1ccc(NC(=O)COc2ccc(/C=C3/C(=O)N(c4cccc(C(=O)O)c4)N=C3C)cc2OC)cc1 |
| InChI | InChI=1S/C29H27N3O7/c1-4-38-23-11-9-21(10-12-23)30-27(33)17-39-25-13-8-19(15-26(25)37-3)14-24-18(2)31-32(28(24)34)22-7-5-6-20(16-22)29(35)36/h5-16H,4,17H2,1-3H3,(H,30,33)(H,35,36)/b24-14+ |
| InChIKey | FINHXEHXJBHOAL-ZVHZXABRSA-N |
| XLogP | 4.62 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|