C29H28BrN3O5 — CID 19655759
2-[2-bromo-6-ethoxy-4-[(E)-[3-methyl-1-(4-methylphenyl)-5-oxopyrazol-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 19655759) has the molecular formula C29H28BrN3O5 and a molecular weight of 578.46 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[(E)-[3-methyl-1-(4-methylphenyl)-5-oxopyrazol-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[(E)-[3-methyl-1-(4-methylphenyl)-5-oxopyrazol-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19655759 |
| Molecular Formula | C29H28BrN3O5 |
| Molecular Weight | 578.46 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[(E)-[3-methyl-1-(4-methylphenyl)-5-oxopyrazol-4-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/C(=O)N(c3ccc(C)cc3)N=C2C)cc(Br)c1OCC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C29H28BrN3O5/c1-5-37-26-16-20(14-22-19(3)32-33(29(22)35)21-12-10-18(2)11-13-21)15-23(30)28(26)38-17-27(34)31-24-8-6-7-9-25(24)36-4/h6-16H,5,17H2,1-4H3,(H,31,34)/b22-14+ |
| InChIKey | PDBLDVSPNOSVFE-HYARGMPZSA-N |
| XLogP | 5.99 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|