C28H24IN3O7 — CID 4174750
4-[4-[[3-iodo-5-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 4174750) has the molecular formula C28H24IN3O7 and a molecular weight of 641.42 g/mol. Its IUPAC name is 4-[4-[[3-iodo-5-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 4-[4-[[3-iodo-5-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 4174750 |
| Molecular Formula | C28H24IN3O7 |
| Molecular Weight | 641.42 g/mol |
| Exact Mass | 641.07 |
| IUPAC Name | 4-[4-[[3-iodo-5-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | COc1ccccc1NC(=O)COc1c(I)cc(C=C2C(=O)N(c3ccc(C(=O)O)cc3)N=C2C)cc1OC |
| InChI | InChI=1S/C28H24IN3O7/c1-16-20(27(34)32(31-16)19-10-8-18(9-11-19)28(35)36)12-17-13-21(29)26(24(14-17)38-3)39-15-25(33)30-22-6-4-5-7-23(22)37-2/h4-14H,15H2,1-3H3,(H,30,33)(H,35,36) |
| InChIKey | WEXZRCBOHPDKKP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|