C32H24BrN3O6 — CID 126381106
2-[4-bromo-2-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methoxyphenyl)acetamide (PubChem CID 126381106) has the molecular formula C32H24BrN3O6 and a molecular weight of 626.46 g/mol. Its IUPAC name is 2-[4-bromo-2-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126381106 |
| Molecular Formula | C32H24BrN3O6 |
| Molecular Weight | 626.46 g/mol |
| Exact Mass | 625.08 |
| IUPAC Name | 2-[4-bromo-2-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(Br)cc2C=C2C(=O)N(c3ccccc3)C(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C32H24BrN3O6/c1-41-26-15-13-23(14-16-26)34-29(37)20-42-28-17-12-22(33)18-21(28)19-27-30(38)35(24-8-4-2-5-9-24)32(40)36(31(27)39)25-10-6-3-7-11-25/h2-19H,20H2,1H3,(H,34,37) |
| InChIKey | YQYRGLIOASFFSI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|