C33H26BrN3O5 — CID 126258991
2-[2-bromo-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126258991) has the molecular formula C33H26BrN3O5 and a molecular weight of 624.49 g/mol. Its IUPAC name is 2-[2-bromo-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126258991 |
| Molecular Formula | C33H26BrN3O5 |
| Molecular Weight | 624.49 g/mol |
| Exact Mass | 623.11 |
| IUPAC Name | 2-[2-bromo-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(C=C3C(=O)N(c4ccccc4)C(=O)N(c4ccccc4)C3=O)cc2Br)c(C)c1 |
| InChI | InChI=1S/C33H26BrN3O5/c1-21-13-15-28(22(2)17-21)35-30(38)20-42-29-16-14-23(19-27(29)34)18-26-31(39)36(24-9-5-3-6-10-24)33(41)37(32(26)40)25-11-7-4-8-12-25/h3-19H,20H2,1-2H3,(H,35,38) |
| InChIKey | DZJYYKNCZIUHFB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.49 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|