C20H17N3O4S — CID 53305542
2-[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 53305542) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is 2-[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 53305542 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(C=C3C(=O)NC(=S)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C20H17N3O4S/c1-12-2-6-14(7-3-12)21-17(24)11-27-15-8-4-13(5-9-15)10-16-18(25)22-20(28)23-19(16)26/h2-10H,11H2,1H3,(H,21,24)(H2,22,23,25,26,28) |
| InChIKey | LUZQVBLLMRGYNX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|