C31H31N3O7 — CID 126231636
2-[4-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126231636) has the molecular formula C31H31N3O7 and a molecular weight of 557.60 g/mol. Its IUPAC name is 2-[4-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126231636 |
| Molecular Formula | C31H31N3O7 |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 2-[4-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCCOc1ccc(N2C(=O)NC(=O)/C(=C\c3ccc(OCC(=O)Nc4ccc(C)cc4)cc3)C2=O)cc1OCC |
| InChI | InChI=1S/C31H31N3O7/c1-4-16-40-26-15-12-23(18-27(26)39-5-2)34-30(37)25(29(36)33-31(34)38)17-21-8-13-24(14-9-21)41-19-28(35)32-22-10-6-20(3)7-11-22/h6-15,17-18H,4-5,16,19H2,1-3H3,(H,32,35)(H,33,36,38)/b25-17+ |
| InChIKey | QSNHNQGBSHWFLT-KOEQRZSOSA-N |
| XLogP | 4.87 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|