C15H14BrF7N2O4 — CID 126042313
methyl 2-[2-bromo-6-ethoxy-4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]phenoxy]acetate (PubChem CID 126042313) has the molecular formula C15H14BrF7N2O4 and a molecular weight of 499.18 g/mol. Its IUPAC name is methyl 2-[2-bromo-6-ethoxy-4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-6-ethoxy-4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126042313 |
| Molecular Formula | C15H14BrF7N2O4 |
| Molecular Weight | 499.18 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | methyl 2-[2-bromo-6-ethoxy-4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]phenoxy]acetate |
| SMILES | CCOc1cc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)cc(Br)c1OCC(=O)OC |
| InChI | InChI=1S/C15H14BrF7N2O4/c1-3-28-10-5-8(4-9(16)12(10)29-7-11(26)27-2)6-24-25-15(22,23)13(17,18)14(19,20)21/h4-6,25H,3,7H2,1-2H3/b24-6+ |
| InChIKey | QNSYTDZNXVESKY-GFXGDVFHSA-N |
| XLogP | 4.11 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.18 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|