C10H10BrN3O4 — CID 135579888
N'-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]oxamide (PubChem CID 135579888) has the molecular formula C10H10BrN3O4 and a molecular weight of 316.11 g/mol. Its IUPAC name is N'-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]oxamide.
| Compound Name | N'-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 135579888 |
| Molecular Formula | C10H10BrN3O4 |
| Molecular Weight | 316.11 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | N'-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1cc(/C=N/NC(=O)C(N)=O)cc(Br)c1O |
| InChI | InChI=1S/C10H10BrN3O4/c1-18-7-3-5(2-6(11)8(7)15)4-13-14-10(17)9(12)16/h2-4,15H,1H3,(H2,12,16)(H,14,17)/b13-4+ |
| InChIKey | QFGTWSKAESBWNU-YIXHJXPBSA-N |
| XLogP | 0.10 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.11 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|