C15H22N2O2 — CID 108957263
2,2-dimethyl-N-(4-methylphenyl)-N'-propan-2-ylpropanediamide (PubChem CID 108957263) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2,2-dimethyl-N-(4-methylphenyl)-N'-propan-2-ylpropanediamide.
| Compound Name | 2,2-dimethyl-N-(4-methylphenyl)-N'-propan-2-ylpropanediamide |
|---|---|
| PubChem CID | 108957263 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2,2-dimethyl-N-(4-methylphenyl)-N'-propan-2-ylpropanediamide |
| SMILES | Cc1ccc(NC(=O)C(C)(C)C(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C15H22N2O2/c1-10(2)16-13(18)15(4,5)14(19)17-12-8-6-11(3)7-9-12/h6-10H,1-5H3,(H,16,18)(H,17,19) |
| InChIKey | CIPBPRCAAHXIRO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|