C13H20N2O2 — CID 113342009
1-(3-hydroxy-2-methylbutan-2-yl)-3-(4-methylphenyl)urea (PubChem CID 113342009) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-(3-hydroxy-2-methylbutan-2-yl)-3-(4-methylphenyl)urea.
| Compound Name | 1-(3-hydroxy-2-methylbutan-2-yl)-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 113342009 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-(3-hydroxy-2-methylbutan-2-yl)-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NC(C)(C)C(C)O)cc1 |
| InChI | InChI=1S/C13H20N2O2/c1-9-5-7-11(8-6-9)14-12(17)15-13(3,4)10(2)16/h5-8,10,16H,1-4H3,(H2,14,15,17) |
| InChIKey | GZXVWJVFAPVOIY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |