C16H16N2O3 — CID 43088004
N-[3-(1,3-benzodioxol-5-ylmethylamino)phenyl]acetamide (PubChem CID 43088004) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-ylmethylamino)phenyl]acetamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-ylmethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 43088004 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-ylmethylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C16H16N2O3/c1-11(19)18-14-4-2-3-13(8-14)17-9-12-5-6-15-16(7-12)21-10-20-15/h2-8,17H,9-10H2,1H3,(H,18,19) |
| InChIKey | KXXXTYHJMYQYRB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |