C21H22ClN3O5 — CID 3938497
N'-[1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-(4-ethylphenoxy)acetohydrazide (PubChem CID 3938497) has the molecular formula C21H22ClN3O5 and a molecular weight of 431.88 g/mol. Its IUPAC name is N'-[1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-(4-ethylphenoxy)acetohydrazide.
| Compound Name | N'-[1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-(4-ethylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 3938497 |
| Molecular Formula | C21H22ClN3O5 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N'-[1-(3-chloro-4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-(4-ethylphenoxy)acetohydrazide |
| SMILES | CCc1ccc(OCC(=O)NNC2CC(=O)N(c3ccc(OC)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H22ClN3O5/c1-3-13-4-7-15(8-5-13)30-12-19(26)24-23-17-11-20(27)25(21(17)28)14-6-9-18(29-2)16(22)10-14/h4-10,17,23H,3,11-12H2,1-2H3,(H,24,26) |
| InChIKey | HMKJNPNNMGPLQX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|