C22H19N3O2 — CID 2962367
N'-acridin-9-yl-2-(3-methylphenoxy)acetohydrazide (PubChem CID 2962367) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is N'-acridin-9-yl-2-(3-methylphenoxy)acetohydrazide.
| Compound Name | N'-acridin-9-yl-2-(3-methylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 2962367 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N'-acridin-9-yl-2-(3-methylphenoxy)acetohydrazide |
| SMILES | Cc1cccc(OCC(=O)NNc2c3ccccc3nc3ccccc23)c1 |
| InChI | InChI=1S/C22H19N3O2/c1-15-7-6-8-16(13-15)27-14-21(26)24-25-22-17-9-2-4-11-19(17)23-20-12-5-3-10-18(20)22/h2-13H,14H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | WXYVQORSQWZKSQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|