C23H20ClN3O2 — CID 15129766
N'-(1-chloroacridin-9-yl)-2-(2,5-dimethylphenoxy)acetohydrazide (PubChem CID 15129766) has the molecular formula C23H20ClN3O2 and a molecular weight of 405.89 g/mol. Its IUPAC name is N'-(1-chloroacridin-9-yl)-2-(2,5-dimethylphenoxy)acetohydrazide.
| Compound Name | N'-(1-chloroacridin-9-yl)-2-(2,5-dimethylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 15129766 |
| Molecular Formula | C23H20ClN3O2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N'-(1-chloroacridin-9-yl)-2-(2,5-dimethylphenoxy)acetohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNc2c3ccccc3nc3cccc(Cl)c23)c1 |
| InChI | InChI=1S/C23H20ClN3O2/c1-14-10-11-15(2)20(12-14)29-13-21(28)26-27-23-16-6-3-4-8-18(16)25-19-9-5-7-17(24)22(19)23/h3-12H,13H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | BSFFRHHJJJRGMK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|