About 2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide
2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide (PubChem CID 134104918) has the molecular formula C25H24ClN3O2
and a molecular weight of 433.94 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide.
Molecular Properties
| Compound Name | 2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide |
| PubChem CID | 134104918 |
| Molecular Formula | C25H24ClN3O2 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NNc2c3ccccc3nc3c(Cl)cccc23)cc1 |
| InChI | InChI=1S/C25H24ClN3O2/c1-25(2,3)16-11-13-17(14-12-16)31-15-22(30)28-29-23-18-7-4-5-10-21(18)27-24-19(23)8-6-9-20(24)26/h4-14H,15H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | BXTAZGRCRVFMCP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide?
The IUPAC name of 2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide (CID 134104918) is 2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide.
What is the SMILES notation for 2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide?
The canonical SMILES for 2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide is CC(C)(C)c1ccc(OCC(=O)NNc2c3ccccc3nc3c(Cl)cccc23)cc1.
What is the InChIKey of 2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide?
The InChIKey is BXTAZGRCRVFMCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24ClN3O2/c1-25(2,3)16-11-13-17(14-12-16)31-15-22(30)28-29-23-18-7-4-5-10-21(18)27-24-19(23)8-6-9-20(24)26/h4-14H,15H2,1-3H3,(H,27,29)(H,28,30).
What are the key properties of 2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide?
2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide has a molecular weight of 433.94 g/mol, XLogP of 5.86, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butylphenoxy)-N'-(4-chloroacridin-9-yl)acetohydrazide is sourced from PubChem (CID 134104918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).