C23H18Cl3N3O3 — CID 15129790
N'-(3-ethoxyacridin-9-yl)-2-(2,4,5-trichlorophenoxy)acetohydrazide (PubChem CID 15129790) has the molecular formula C23H18Cl3N3O3 and a molecular weight of 490.77 g/mol. Its IUPAC name is N'-(3-ethoxyacridin-9-yl)-2-(2,4,5-trichlorophenoxy)acetohydrazide.
| Compound Name | N'-(3-ethoxyacridin-9-yl)-2-(2,4,5-trichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 15129790 |
| Molecular Formula | C23H18Cl3N3O3 |
| Molecular Weight | 490.77 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | N'-(3-ethoxyacridin-9-yl)-2-(2,4,5-trichlorophenoxy)acetohydrazide |
| SMILES | CCOc1ccc2c(NNC(=O)COc3cc(Cl)c(Cl)cc3Cl)c3ccccc3nc2c1 |
| InChI | InChI=1S/C23H18Cl3N3O3/c1-2-31-13-7-8-15-20(9-13)27-19-6-4-3-5-14(19)23(15)29-28-22(30)12-32-21-11-17(25)16(24)10-18(21)26/h3-11H,2,12H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | CKFKMGXYMQGOQN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.77 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|