C17H15Cl3N2O3S — CID 18525661
N-[(4-ethoxyphenyl)carbamothioyl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 18525661) has the molecular formula C17H15Cl3N2O3S and a molecular weight of 433.74 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)carbamothioyl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(4-ethoxyphenyl)carbamothioyl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 18525661 |
| Molecular Formula | C17H15Cl3N2O3S |
| Molecular Weight | 433.74 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | N-[(4-ethoxyphenyl)carbamothioyl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CCOc1ccc(NC(=S)NC(=O)COc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H15Cl3N2O3S/c1-2-24-11-5-3-10(4-6-11)21-17(26)22-16(23)9-25-15-8-13(19)12(18)7-14(15)20/h3-8H,2,9H2,1H3,(H2,21,22,23,26) |
| InChIKey | KPWUQPFEXNDWKL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.74 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|