C15H11Cl3N4O4S — CID 17375002
1-(4-nitrophenyl)-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiourea (PubChem CID 17375002) has the molecular formula C15H11Cl3N4O4S and a molecular weight of 449.70 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiourea.
| Compound Name | 1-(4-nitrophenyl)-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 17375002 |
| Molecular Formula | C15H11Cl3N4O4S |
| Molecular Weight | 449.70 g/mol |
| Exact Mass | 447.96 |
| IUPAC Name | 1-(4-nitrophenyl)-3-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]thiourea |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NNC(=S)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11Cl3N4O4S/c16-10-5-12(18)13(6-11(10)17)26-7-14(23)20-21-15(27)19-8-1-3-9(4-2-8)22(24)25/h1-6H,7H2,(H,20,23)(H2,19,21,27) |
| InChIKey | YTKWKWVBTGEPLE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|