C13H14N2O4 — CID 51602829
3-[[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]amino]propanoic acid (PubChem CID 51602829) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 3-[[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]amino]propanoic acid.
| Compound Name | 3-[[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 51602829 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-[[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]amino]propanoic acid |
| SMILES | O=C(O)CCN[C@H]1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C13H14N2O4/c16-11-8-10(14-7-6-12(17)18)13(19)15(11)9-4-2-1-3-5-9/h1-5,10,14H,6-8H2,(H,17,18)/t10-/m0/s1 |
| InChIKey | NCXSZKSXKZAIDF-JTQLQIEISA-N |
| XLogP | 0.38 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|