C13H17ClN2O2 — CID 53440488
1-phenyl-3-(propylamino)pyrrolidine-2,5-dione;hydrochloride (PubChem CID 53440488) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 1-phenyl-3-(propylamino)pyrrolidine-2,5-dione;hydrochloride.
| Compound Name | 1-phenyl-3-(propylamino)pyrrolidine-2,5-dione;hydrochloride |
|---|---|
| PubChem CID | 53440488 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-phenyl-3-(propylamino)pyrrolidine-2,5-dione;hydrochloride |
| SMILES | CCCNC1CC(=O)N(c2ccccc2)C1=O.Cl |
| InChI | InChI=1S/C13H16N2O2.ClH/c1-2-8-14-11-9-12(16)15(13(11)17)10-6-4-3-5-7-10;/h3-7,11,14H,2,8-9H2,1H3;1H |
| InChIKey | DZHUJBNAUUNLRP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|