C21H23FN4O4S2 — CID 2273391
3-ethyl-1-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-1-[2-(4-sulfamoylphenyl)ethyl]thiourea (PubChem CID 2273391) has the molecular formula C21H23FN4O4S2 and a molecular weight of 478.57 g/mol. Its IUPAC name is 3-ethyl-1-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-1-[2-(4-sulfamoylphenyl)ethyl]thiourea.
| Compound Name | 3-ethyl-1-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-1-[2-(4-sulfamoylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 2273391 |
| Molecular Formula | C21H23FN4O4S2 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 3-ethyl-1-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-1-[2-(4-sulfamoylphenyl)ethyl]thiourea |
| SMILES | CCNC(=S)N(CCc1ccc(S(N)(=O)=O)cc1)[C@@H]1CC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C21H23FN4O4S2/c1-2-24-21(31)25(12-11-14-3-9-17(10-4-14)32(23,29)30)18-13-19(27)26(20(18)28)16-7-5-15(22)6-8-16/h3-10,18H,2,11-13H2,1H3,(H,24,31)(H2,23,29,30)/t18-/m1/s1 |
| InChIKey | QMTFBVNXRXWTQT-GOSISDBHSA-N |
| XLogP | 1.54 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|