C25H26ClN3O7 — CID 23860639
ethyl 4-[3-[(4-chloro-3-nitrobenzoyl)-(2-methylbutan-2-yl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23860639) has the molecular formula C25H26ClN3O7 and a molecular weight of 515.95 g/mol. Its IUPAC name is ethyl 4-[3-[(4-chloro-3-nitrobenzoyl)-(2-methylbutan-2-yl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(4-chloro-3-nitrobenzoyl)-(2-methylbutan-2-yl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23860639 |
| Molecular Formula | C25H26ClN3O7 |
| Molecular Weight | 515.95 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | ethyl 4-[3-[(4-chloro-3-nitrobenzoyl)-(2-methylbutan-2-yl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N(C(=O)c3ccc(Cl)c([N+](=O)[O-])c3)C(C)(C)CC)C2=O)cc1 |
| InChI | InChI=1S/C25H26ClN3O7/c1-5-25(3,4)28(22(31)16-9-12-18(26)19(13-16)29(34)35)20-14-21(30)27(23(20)32)17-10-7-15(8-11-17)24(33)36-6-2/h7-13,20H,5-6,14H2,1-4H3 |
| InChIKey | PJZYHOZGAPHWNC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.95 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|