C25H25ClN4O6 — CID 23832186
N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-4-chloro-N-cyclohexyl-3-nitrobenzamide (PubChem CID 23832186) has the molecular formula C25H25ClN4O6 and a molecular weight of 512.95 g/mol. Its IUPAC name is N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-4-chloro-N-cyclohexyl-3-nitrobenzamide.
| Compound Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-4-chloro-N-cyclohexyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 23832186 |
| Molecular Formula | C25H25ClN4O6 |
| Molecular Weight | 512.95 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-4-chloro-N-cyclohexyl-3-nitrobenzamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)CC(N(C(=O)c3ccc(Cl)c([N+](=O)[O-])c3)C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C25H25ClN4O6/c1-15(31)27-17-8-10-19(11-9-17)29-23(32)14-22(25(29)34)28(18-5-3-2-4-6-18)24(33)16-7-12-20(26)21(13-16)30(35)36/h7-13,18,22H,2-6,14H2,1H3,(H,27,31) |
| InChIKey | BUMHAXKDIVJKCO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.95 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|