C30H25ClN4O6S — CID 23972401
4-chloro-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-3-nitro-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 23972401) has the molecular formula C30H25ClN4O6S and a molecular weight of 605.07 g/mol. Its IUPAC name is 4-chloro-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-3-nitro-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-chloro-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-3-nitro-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 23972401 |
| Molecular Formula | C30H25ClN4O6S |
| Molecular Weight | 605.07 g/mol |
| Exact Mass | 604.12 |
| IUPAC Name | 4-chloro-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-3-nitro-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)CC(N(CC5CCCO5)C(=O)c5ccc(Cl)c([N+](=O)[O-])c5)C4=O)cc3)sc2c1 |
| InChI | InChI=1S/C30H25ClN4O6S/c1-17-4-11-23-26(13-17)42-28(32-23)18-5-8-20(9-6-18)34-27(36)15-25(30(34)38)33(16-21-3-2-12-41-21)29(37)19-7-10-22(31)24(14-19)35(39)40/h4-11,13-14,21,25H,2-3,12,15-16H2,1H3 |
| InChIKey | XGYXCMCUYJCNQR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 122.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.07 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|