C27H23N3O7 — CID 23944531
[4-[3-[(4-nitrobenzoyl)-(2-phenylethyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate (PubChem CID 23944531) has the molecular formula C27H23N3O7 and a molecular weight of 501.50 g/mol. Its IUPAC name is [4-[3-[(4-nitrobenzoyl)-(2-phenylethyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate.
| Compound Name | [4-[3-[(4-nitrobenzoyl)-(2-phenylethyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 23944531 |
| Molecular Formula | C27H23N3O7 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | [4-[3-[(4-nitrobenzoyl)-(2-phenylethyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)CC(N(CCc3ccccc3)C(=O)c3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H23N3O7/c1-18(31)37-23-13-11-21(12-14-23)29-25(32)17-24(27(29)34)28(16-15-19-5-3-2-4-6-19)26(33)20-7-9-22(10-8-20)30(35)36/h2-14,24H,15-17H2,1H3 |
| InChIKey | SCOXWOZJBFUCFD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|