C31H35N3O4 — CID 23888664
N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)adamantane-1-carboxamide (PubChem CID 23888664) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)adamantane-1-carboxamide.
| Compound Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 23888664 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)adamantane-1-carboxamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)CC(N(CCc3ccccc3)C(=O)C34CC5CC(CC(C5)C3)C4)C2=O)cc1 |
| InChI | InChI=1S/C31H35N3O4/c1-20(35)32-25-7-9-26(10-8-25)34-28(36)16-27(29(34)37)33(12-11-21-5-3-2-4-6-21)30(38)31-17-22-13-23(18-31)15-24(14-22)19-31/h2-10,22-24,27H,11-19H2,1H3,(H,32,35) |
| InChIKey | VXBDTDRSYKWFMC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|