C28H30N4O2S — CID 51434028
3-[4-(dimethylamino)phenyl]-1-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-1-(2-phenylethyl)thiourea (PubChem CID 51434028) has the molecular formula C28H30N4O2S and a molecular weight of 486.64 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-1-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-1-(2-phenylethyl)thiourea.
| Compound Name | 3-[4-(dimethylamino)phenyl]-1-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-1-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 51434028 |
| Molecular Formula | C28H30N4O2S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-1-[(3S)-1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-1-(2-phenylethyl)thiourea |
| SMILES | Cc1ccc(N2C(=O)C[C@H](N(CCc3ccccc3)C(=S)Nc3ccc(N(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H30N4O2S/c1-20-9-13-24(14-10-20)32-26(33)19-25(27(32)34)31(18-17-21-7-5-4-6-8-21)28(35)29-22-11-15-23(16-12-22)30(2)3/h4-16,25H,17-19H2,1-3H3,(H,29,35)/t25-/m0/s1 |
| InChIKey | TXEZIOPWRJLNTP-VWLOTQADSA-N |
| XLogP | 4.63 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|