C28H28FIN2O3 — CID 23774594
N-[(4-fluorophenyl)methyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide (PubChem CID 23774594) has the molecular formula C28H28FIN2O3 and a molecular weight of 586.45 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 23774594 |
| Molecular Formula | C28H28FIN2O3 |
| Molecular Weight | 586.45 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]adamantane-1-carboxamide |
| SMILES | O=C1CC(N(Cc2ccc(F)cc2)C(=O)C23CC4CC(CC(C4)C2)C3)C(=O)N1c1ccc(I)cc1 |
| InChI | InChI=1S/C28H28FIN2O3/c29-21-3-1-17(2-4-21)16-31(27(35)28-13-18-9-19(14-28)11-20(10-18)15-28)24-12-25(33)32(26(24)34)23-7-5-22(30)6-8-23/h1-8,18-20,24H,9-16H2 |
| InChIKey | RGDARTLQOLJYSJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|